Pigmentgeel 151-Corimax Geel H4G
Tegniese parameters van Pigmentgeel 151
| Kleurindeks No. | Pigmentgeel 151 |
| Produk Naam | Corimax Geel H4G |
| Produk Kategorie | Organiese pigment |
| CAS-nommer | 31837-42-0 |
| EU-nommer | 250-830-4 |
| Chemiese familie | Mono azo |
| Molekulêre gewig | 381.34 |
| Molekulêre formule | C18H15N5O5 |
| PH-waarde | 7 |
| digtheid | 1.6 |
| Olieabsorpsie (ml / 100g)% | 45 |
| Ligvastheid (deklaag) | 6-7 |
| Hittebestandheid (deklaag) | 200 |
| Ligvastheid (plastiek) | 7-8 |
| Hittebestandheid (plastiek) | 260 |
| Water weerstand | 5 |
| Olieweerstand | 5 |
| Suurweerstand | 5 |
| Weerstand teen alkali | 5 |
Kleur | ![]() |
| Hue verspreiding |
Molekulêre struktuur:

aansoek:
Word aanbeveel vir motorverf, argitektoniese bedekkings, spoelbedekkings, industriële verf, poeierbedekkings, drukpaste, PVC, rubber, PS, PP, PE, PU, inkt op waterbasis, oplosmiddel-ink, UV-ink.
Kan in offset ink gebruik word.
Verwante inligting
Pigmentgeel 151 gee 'n kleur wat groener is as CI. Pigmentgeel 154 en rooier as Pigmentgeel 175. Die kleurhoek is 97,4 grade (1 / 3SD). Die spesifieke oppervlakte van Hostaperm Yellow H4G is 23m2 / g, wat 'n goeie wegkruipplek het. Die snelheid is uitstekend. Die kleurmonster van alkydtrinitrilhars word vir 1 jaar aan Florida blootgestel. Die weervastheid het 'n grys kaart van graad 5, en die verdunde kleur (1; 3TiO2) is nog steeds graad 4; 1/3 Die hittebestendigheidstabiliteit van HDPE in standaarddiepte is 260 ° C / 5min; Dit is geskik vir hoë-end industriële bedekkings, motorbewerking (OEM), en kan gekombineer word met ftalocyaniene en anorganiese pigmente, en kan ook gebruik word om polyester-gelamineerde plastiekfilms te druk.
aliases:13980; Benzoic acid, 2-(2-(1-(((2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)amino)carbonyl)-2-oxopropyl)diazenyl)-; pigment yellow 151; 2-[[1-[[(2,3-Dihydro-2-oxo-1H-benzimidazol-5-yl)amino]carbonyl]-2-oxopropyl]azo]benzoic acid; C.I. 13980; fast yellow h4g; 2-[2-OXO-1-[(2-OXO-1,3-DIHYDROBENZOIMIDAZOL-5-YL)CARBAMOY; PROPYL]DIAZENYLBENZOIC ACID; Benzoic acid, 2-1-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)aminocarbonyl-2-oxopropylazo-; BENZIMIDAZOLONE YELLOS H4G; Benzimidazolone Yellow H4G(Pigment Yellow 151); 2-[(E)-{1,3-dioxo-1-[(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)amino]butan-2-yl}diazenyl]benzoic acid; 2-[2-oxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamoyl]propyl]azobenzoic acid.
IUPAC Name: 2-[[1,3-dioxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butan-2-yl]diazenyl]benzoic acid
InChI : InChI=1S/C18H15N5O5/c1-9(24)15(23-22-12-5-3-2-4-11(12)17(26)27)16(25)19-10-6-7-13-14(8-10)21-18(28)20-13/h2-8,15H,1H3,(H,19,25)(H,26,27)(H2,20,21,28)
InChIKey: YMFWVWDPPIWORA-UHFFFAOYSA-N
Canonical SMILES: CC(=O)C(C(=O)NC1=CC2=C(C=C1)NC(=O)N2)N=NC3=CC=CC=C3C(=O)O
Chemiese en Fisiese Eienskappe
Rekenaar eienskappe
| Eiendomsnaam | Eiendomswaarde |
| Molekulêre gewig | 381.3 g/mol |
| XLogP3-AA | 1.7 |
| Waterstofbondskenkertelling | 4 |
| Waterstofbinding-aanvaardertelling | 7 |
| Roteerbare verbandtelling | 6 |
| Presiese massa | 381.10731860 g/mol |
| Monoisotopiese massa | 381.10731860 g/mol |
| Topologiese Pooloppervlakte | 149Ų |
| Swaar atoomtelling | 28 |
| Formele aanklag | 0 |
| Kompleksiteit | 681 |
| Isotoop atoomtelling | 0 |
| Gedefinieerde Atoom Stereocenter telling | 0 |
| Ongedefinieerde Atoom Stereosentrum telling | 1 |
| Gedefinieerde Bond Stereocenter telling | 0 |
| Ongedefinieerde Bond Stereocenter telling | 0 |
| Kovalent-gebonde Eenheidtelling | 1 |
| Samestelling is kanonaliseer | Ja |
Handling and storage:
Handling
Advice on protection against fire and explosion
Keep away from sources of ignition
Avoid formation of dust
Take precautionary measures against electrostatic loading
Storage
Be kept in a ventilated, cool and dry place, it should be also avoided to contact with acid material and expose to air. Keep container dry
video:











